C12H16ClNO2 — CID 60961630
N-[(3-chlorophenyl)methyl]-1-(1,4-dioxan-2-yl)methanamine (PubChem CID 60961630) has the molecular formula C12H16ClNO2 and a molecular weight of 241.72 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-1-(1,4-dioxan-2-yl)methanamine.
| Compound Name | N-[(3-chlorophenyl)methyl]-1-(1,4-dioxan-2-yl)methanamine |
|---|---|
| PubChem CID | 60961630 |
| Molecular Formula | C12H16ClNO2 |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-1-(1,4-dioxan-2-yl)methanamine |
| SMILES | Clc1cccc(CNCC2COCCO2)c1 |
| InChI | InChI=1S/C12H16ClNO2/c13-11-3-1-2-10(6-11)7-14-8-12-9-15-4-5-16-12/h1-3,6,12,14H,4-5,7-9H2 |
| InChIKey | FZIPMVCCMKBCBZ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |