C12H16INO2 — CID 65477569
1-(1,4-dioxan-2-yl)-N-[(4-iodophenyl)methyl]methanamine (PubChem CID 65477569) has the molecular formula C12H16INO2 and a molecular weight of 333.17 g/mol. Its IUPAC name is 1-(1,4-dioxan-2-yl)-N-[(4-iodophenyl)methyl]methanamine.
| Compound Name | 1-(1,4-dioxan-2-yl)-N-[(4-iodophenyl)methyl]methanamine |
|---|---|
| PubChem CID | 65477569 |
| Molecular Formula | C12H16INO2 |
| Molecular Weight | 333.17 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 1-(1,4-dioxan-2-yl)-N-[(4-iodophenyl)methyl]methanamine |
| SMILES | Ic1ccc(CNCC2COCCO2)cc1 |
| InChI | InChI=1S/C12H16INO2/c13-11-3-1-10(2-4-11)7-14-8-12-9-15-5-6-16-12/h1-4,12,14H,5-9H2 |
| InChIKey | YKDQZYVJWJSFFZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.17 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|