C14H21NO5 — CID 60962285
4-[(1,4-dioxan-2-ylmethylamino)methyl]-2,6-dimethoxyphenol (PubChem CID 60962285) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is 4-[(1,4-dioxan-2-ylmethylamino)methyl]-2,6-dimethoxyphenol.
| Compound Name | 4-[(1,4-dioxan-2-ylmethylamino)methyl]-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 60962285 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 4-[(1,4-dioxan-2-ylmethylamino)methyl]-2,6-dimethoxyphenol |
| SMILES | COc1cc(CNCC2COCCO2)cc(OC)c1O |
| InChI | InChI=1S/C14H21NO5/c1-17-12-5-10(6-13(18-2)14(12)16)7-15-8-11-9-19-3-4-20-11/h5-6,11,15-16H,3-4,7-9H2,1-2H3 |
| InChIKey | RGRMIAYECNLQLH-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |