C13H18BrNO4 — CID 54893848
2-bromo-4-[(1,4-dioxan-2-ylmethylamino)methyl]-6-methoxyphenol (PubChem CID 54893848) has the molecular formula C13H18BrNO4 and a molecular weight of 332.19 g/mol. Its IUPAC name is 2-bromo-4-[(1,4-dioxan-2-ylmethylamino)methyl]-6-methoxyphenol.
| Compound Name | 2-bromo-4-[(1,4-dioxan-2-ylmethylamino)methyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 54893848 |
| Molecular Formula | C13H18BrNO4 |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 2-bromo-4-[(1,4-dioxan-2-ylmethylamino)methyl]-6-methoxyphenol |
| SMILES | COc1cc(CNCC2COCCO2)cc(Br)c1O |
| InChI | InChI=1S/C13H18BrNO4/c1-17-12-5-9(4-11(14)13(12)16)6-15-7-10-8-18-2-3-19-10/h4-5,10,15-16H,2-3,6-8H2,1H3 |
| InChIKey | PWPLJTMLWUFRJE-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |