C12H16BrNO3 — CID 60962286
2-bromo-4-[(1,4-dioxan-2-ylmethylamino)methyl]phenol (PubChem CID 60962286) has the molecular formula C12H16BrNO3 and a molecular weight of 302.17 g/mol. Its IUPAC name is 2-bromo-4-[(1,4-dioxan-2-ylmethylamino)methyl]phenol.
| Compound Name | 2-bromo-4-[(1,4-dioxan-2-ylmethylamino)methyl]phenol |
|---|---|
| PubChem CID | 60962286 |
| Molecular Formula | C12H16BrNO3 |
| Molecular Weight | 302.17 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 2-bromo-4-[(1,4-dioxan-2-ylmethylamino)methyl]phenol |
| SMILES | Oc1ccc(CNCC2COCCO2)cc1Br |
| InChI | InChI=1S/C12H16BrNO3/c13-11-5-9(1-2-12(11)15)6-14-7-10-8-16-3-4-17-10/h1-2,5,10,14-15H,3-4,6-8H2 |
| InChIKey | PRYRSCQXWNWKMX-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.17 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |