C10H16N2O2 — CID 66408972
1-(1,4-dioxan-2-yl)-N-(1H-pyrrol-3-ylmethyl)methanamine (PubChem CID 66408972) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 1-(1,4-dioxan-2-yl)-N-(1H-pyrrol-3-ylmethyl)methanamine.
| Compound Name | 1-(1,4-dioxan-2-yl)-N-(1H-pyrrol-3-ylmethyl)methanamine |
|---|---|
| PubChem CID | 66408972 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 1-(1,4-dioxan-2-yl)-N-(1H-pyrrol-3-ylmethyl)methanamine |
| SMILES | c1cc(CNCC2COCCO2)c[nH]1 |
| InChI | InChI=1S/C10H16N2O2/c1-2-11-5-9(1)6-12-7-10-8-13-3-4-14-10/h1-2,5,10-12H,3-4,6-8H2 |
| InChIKey | PSKCRRGHJZFQAB-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 46.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |