C10H16N2 — CID 115686102
1-(2-methylcyclopropyl)-N-(1H-pyrrol-3-ylmethyl)methanamine (PubChem CID 115686102) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 1-(2-methylcyclopropyl)-N-(1H-pyrrol-3-ylmethyl)methanamine.
| Compound Name | 1-(2-methylcyclopropyl)-N-(1H-pyrrol-3-ylmethyl)methanamine |
|---|---|
| PubChem CID | 115686102 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 1-(2-methylcyclopropyl)-N-(1H-pyrrol-3-ylmethyl)methanamine |
| SMILES | CC1CC1CNCc1cc[nH]c1 |
| InChI | InChI=1S/C10H16N2/c1-8-4-10(8)7-12-6-9-2-3-11-5-9/h2-3,5,8,10-12H,4,6-7H2,1H3 |
| InChIKey | UBJUPBFMHDRQIY-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |