C13H22N2 — CID 66409634
1-(2-methylcyclohexyl)-N-(1H-pyrrol-3-ylmethyl)methanamine (PubChem CID 66409634) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 1-(2-methylcyclohexyl)-N-(1H-pyrrol-3-ylmethyl)methanamine.
| Compound Name | 1-(2-methylcyclohexyl)-N-(1H-pyrrol-3-ylmethyl)methanamine |
|---|---|
| PubChem CID | 66409634 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 1-(2-methylcyclohexyl)-N-(1H-pyrrol-3-ylmethyl)methanamine |
| SMILES | CC1CCCCC1CNCc1cc[nH]c1 |
| InChI | InChI=1S/C13H22N2/c1-11-4-2-3-5-13(11)10-15-9-12-6-7-14-8-12/h6-8,11,13-15H,2-5,9-10H2,1H3 |
| InChIKey | VQUPMXHQKHWGAY-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |