C15H23N — CID 107416782
1-(2-methylcyclopentyl)-N-[(4-methylphenyl)methyl]methanamine (PubChem CID 107416782) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is 1-(2-methylcyclopentyl)-N-[(4-methylphenyl)methyl]methanamine.
| Compound Name | 1-(2-methylcyclopentyl)-N-[(4-methylphenyl)methyl]methanamine |
|---|---|
| PubChem CID | 107416782 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 1-(2-methylcyclopentyl)-N-[(4-methylphenyl)methyl]methanamine |
| SMILES | Cc1ccc(CNCC2CCCC2C)cc1 |
| InChI | InChI=1S/C15H23N/c1-12-6-8-14(9-7-12)10-16-11-15-5-3-4-13(15)2/h6-9,13,15-16H,3-5,10-11H2,1-2H3 |
| InChIKey | ROKJZFXBEADQDH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |