C11H18N2 — CID 115686124
2-cyclopropyl-N-(1H-pyrrol-3-ylmethyl)propan-1-amine (PubChem CID 115686124) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 2-cyclopropyl-N-(1H-pyrrol-3-ylmethyl)propan-1-amine.
| Compound Name | 2-cyclopropyl-N-(1H-pyrrol-3-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 115686124 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 2-cyclopropyl-N-(1H-pyrrol-3-ylmethyl)propan-1-amine |
| SMILES | CC(CNCc1cc[nH]c1)C1CC1 |
| InChI | InChI=1S/C11H18N2/c1-9(11-2-3-11)6-13-8-10-4-5-12-7-10/h4-5,7,9,11-13H,2-3,6,8H2,1H3 |
| InChIKey | XRYPAUQIXYEOLV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |