C11H18N2O2 — CID 115250331
3-methyl-2-[(1H-pyrrol-3-ylmethylamino)methyl]butanoic acid (PubChem CID 115250331) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 3-methyl-2-[(1H-pyrrol-3-ylmethylamino)methyl]butanoic acid.
| Compound Name | 3-methyl-2-[(1H-pyrrol-3-ylmethylamino)methyl]butanoic acid |
|---|---|
| PubChem CID | 115250331 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 3-methyl-2-[(1H-pyrrol-3-ylmethylamino)methyl]butanoic acid |
| SMILES | CC(C)C(CNCc1cc[nH]c1)C(=O)O |
| InChI | InChI=1S/C11H18N2O2/c1-8(2)10(11(14)15)7-13-6-9-3-4-12-5-9/h3-5,8,10,12-13H,6-7H2,1-2H3,(H,14,15) |
| InChIKey | HAKFLRBJILGWEK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |