C9H13BrN2O — CID 106384571
2-bromo-2-methyl-N-(1H-pyrrol-3-ylmethyl)propanamide (PubChem CID 106384571) has the molecular formula C9H13BrN2O and a molecular weight of 245.12 g/mol. Its IUPAC name is 2-bromo-2-methyl-N-(1H-pyrrol-3-ylmethyl)propanamide.
| Compound Name | 2-bromo-2-methyl-N-(1H-pyrrol-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 106384571 |
| Molecular Formula | C9H13BrN2O |
| Molecular Weight | 245.12 g/mol |
| Exact Mass | 244.02 |
| IUPAC Name | 2-bromo-2-methyl-N-(1H-pyrrol-3-ylmethyl)propanamide |
| SMILES | CC(C)(Br)C(=O)NCc1cc[nH]c1 |
| InChI | InChI=1S/C9H13BrN2O/c1-9(2,10)8(13)12-6-7-3-4-11-5-7/h3-5,11H,6H2,1-2H3,(H,12,13) |
| InChIKey | LHAFEDYIXGXPSB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.12 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|