C13H23N3O — CID 106384758
3-amino-5,5-dimethyl-N-(1H-pyrrol-3-ylmethyl)hexanamide (PubChem CID 106384758) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is 3-amino-5,5-dimethyl-N-(1H-pyrrol-3-ylmethyl)hexanamide.
| Compound Name | 3-amino-5,5-dimethyl-N-(1H-pyrrol-3-ylmethyl)hexanamide |
|---|---|
| PubChem CID | 106384758 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 3-amino-5,5-dimethyl-N-(1H-pyrrol-3-ylmethyl)hexanamide |
| SMILES | CC(C)(C)CC(N)CC(=O)NCc1cc[nH]c1 |
| InChI | InChI=1S/C13H23N3O/c1-13(2,3)7-11(14)6-12(17)16-9-10-4-5-15-8-10/h4-5,8,11,15H,6-7,9,14H2,1-3H3,(H,16,17) |
| InChIKey | MMVOOYAPRJBILB-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |