C11H14N2O3 — CID 106384463
(E)-2,3-dimethyl-4-oxo-4-(1H-pyrrol-3-ylmethylamino)but-2-enoic acid (PubChem CID 106384463) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is (E)-2,3-dimethyl-4-oxo-4-(1H-pyrrol-3-ylmethylamino)but-2-enoic acid.
| Compound Name | (E)-2,3-dimethyl-4-oxo-4-(1H-pyrrol-3-ylmethylamino)but-2-enoic acid |
|---|---|
| PubChem CID | 106384463 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | (E)-2,3-dimethyl-4-oxo-4-(1H-pyrrol-3-ylmethylamino)but-2-enoic acid |
| SMILES | C/C(C(=O)O)=C(/C)C(=O)NCc1cc[nH]c1 |
| InChI | InChI=1S/C11H14N2O3/c1-7(8(2)11(15)16)10(14)13-6-9-3-4-12-5-9/h3-5,12H,6H2,1-2H3,(H,13,14)(H,15,16)/b8-7+ |
| InChIKey | YMVGYJQCSRRRDO-BQYQJAHWSA-N |
| XLogP | 1.05 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|