C7H10F2N2 — CID 115405774
2,2-difluoro-N-(1H-pyrrol-3-ylmethyl)ethanamine (PubChem CID 115405774) has the molecular formula C7H10F2N2 and a molecular weight of 160.17 g/mol. Its IUPAC name is 2,2-difluoro-N-(1H-pyrrol-3-ylmethyl)ethanamine.
| Compound Name | 2,2-difluoro-N-(1H-pyrrol-3-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 115405774 |
| Molecular Formula | C7H10F2N2 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.08 |
| IUPAC Name | 2,2-difluoro-N-(1H-pyrrol-3-ylmethyl)ethanamine |
| SMILES | FC(F)CNCc1cc[nH]c1 |
| InChI | InChI=1S/C7H10F2N2/c8-7(9)5-11-4-6-1-2-10-3-6/h1-3,7,10-11H,4-5H2 |
| InChIKey | QLAMWAHYLABHOZ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |