C13H23N3 — CID 115686191
N'-cyclopropyl-N'-propan-2-yl-N-(1H-pyrrol-3-ylmethyl)ethane-1,2-diamine (PubChem CID 115686191) has the molecular formula C13H23N3 and a molecular weight of 221.35 g/mol. Its IUPAC name is N'-cyclopropyl-N'-propan-2-yl-N-(1H-pyrrol-3-ylmethyl)ethane-1,2-diamine.
| Compound Name | N'-cyclopropyl-N'-propan-2-yl-N-(1H-pyrrol-3-ylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 115686191 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | N'-cyclopropyl-N'-propan-2-yl-N-(1H-pyrrol-3-ylmethyl)ethane-1,2-diamine |
| SMILES | CC(C)N(CCNCc1cc[nH]c1)C1CC1 |
| InChI | InChI=1S/C13H23N3/c1-11(2)16(13-3-4-13)8-7-15-10-12-5-6-14-9-12/h5-6,9,11,13-15H,3-4,7-8,10H2,1-2H3 |
| InChIKey | YOWJYMJPKBZIMZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|