C13H29ClN2 — CID 115615727
N'-cyclopropyl-N-(2,2-dimethylpropyl)-N'-propan-2-ylethane-1,2-diamine;hydrochloride (PubChem CID 115615727) has the molecular formula C13H29ClN2 and a molecular weight of 248.84 g/mol. Its IUPAC name is N'-cyclopropyl-N-(2,2-dimethylpropyl)-N'-propan-2-ylethane-1,2-diamine;hydrochloride.
| Compound Name | N'-cyclopropyl-N-(2,2-dimethylpropyl)-N'-propan-2-ylethane-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 115615727 |
| Molecular Formula | C13H29ClN2 |
| Molecular Weight | 248.84 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | N'-cyclopropyl-N-(2,2-dimethylpropyl)-N'-propan-2-ylethane-1,2-diamine;hydrochloride |
| SMILES | CC(C)N(CCNCC(C)(C)C)C1CC1.Cl |
| InChI | InChI=1S/C13H28N2.ClH/c1-11(2)15(12-6-7-12)9-8-14-10-13(3,4)5;/h11-12,14H,6-10H2,1-5H3;1H |
| InChIKey | LTTRMBXUEHNJEX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.84 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|