C12H29ClN2 — CID 115607911
N'-butan-2-yl-N-(2,2-dimethylpropyl)-N'-methylethane-1,2-diamine;hydrochloride (PubChem CID 115607911) has the molecular formula C12H29ClN2 and a molecular weight of 236.83 g/mol. Its IUPAC name is N'-butan-2-yl-N-(2,2-dimethylpropyl)-N'-methylethane-1,2-diamine;hydrochloride.
| Compound Name | N'-butan-2-yl-N-(2,2-dimethylpropyl)-N'-methylethane-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 115607911 |
| Molecular Formula | C12H29ClN2 |
| Molecular Weight | 236.83 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | N'-butan-2-yl-N-(2,2-dimethylpropyl)-N'-methylethane-1,2-diamine;hydrochloride |
| SMILES | CCC(C)N(C)CCNCC(C)(C)C.Cl |
| InChI | InChI=1S/C12H28N2.ClH/c1-7-11(2)14(6)9-8-13-10-12(3,4)5;/h11,13H,7-10H2,1-6H3;1H |
| InChIKey | DUPGCJFOXMFPPU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.83 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|