C10H20N2 — CID 62560907
N'-butan-2-yl-N'-methyl-N-prop-2-ynylethane-1,2-diamine (PubChem CID 62560907) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is N'-butan-2-yl-N'-methyl-N-prop-2-ynylethane-1,2-diamine.
| Compound Name | N'-butan-2-yl-N'-methyl-N-prop-2-ynylethane-1,2-diamine |
|---|---|
| PubChem CID | 62560907 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | N'-butan-2-yl-N'-methyl-N-prop-2-ynylethane-1,2-diamine |
| SMILES | C#CCNCCN(C)C(C)CC |
| InChI | InChI=1S/C10H20N2/c1-5-7-11-8-9-12(4)10(3)6-2/h1,10-11H,6-9H2,2-4H3 |
| InChIKey | YMBHAPLYXARUGB-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|