C10H21F3N2 — CID 115622503
N-(2,2-dimethylpropyl)-N'-methyl-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine (PubChem CID 115622503) has the molecular formula C10H21F3N2 and a molecular weight of 226.29 g/mol. Its IUPAC name is N-(2,2-dimethylpropyl)-N'-methyl-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine.
| Compound Name | N-(2,2-dimethylpropyl)-N'-methyl-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 115622503 |
| Molecular Formula | C10H21F3N2 |
| Molecular Weight | 226.29 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | N-(2,2-dimethylpropyl)-N'-methyl-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
| SMILES | CN(CCNCC(C)(C)C)CC(F)(F)F |
| InChI | InChI=1S/C10H21F3N2/c1-9(2,3)7-14-5-6-15(4)8-10(11,12)13/h14H,5-8H2,1-4H3 |
| InChIKey | QZMVVPYZVHRVHG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|