C15H27F9N4 — CID 140748013
N-methyl-N',N'-bis[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine (PubChem CID 140748013) has the molecular formula C15H27F9N4 and a molecular weight of 434.39 g/mol. Its IUPAC name is N-methyl-N',N'-bis[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine.
| Compound Name | N-methyl-N',N'-bis[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 140748013 |
| Molecular Formula | C15H27F9N4 |
| Molecular Weight | 434.39 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | N-methyl-N',N'-bis[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
| SMILES | CN(CCN(CCN(C)CC(F)(F)F)CCN(C)CC(F)(F)F)CC(F)(F)F |
| InChI | InChI=1S/C15H27F9N4/c1-25(10-13(16,17)18)4-7-28(8-5-26(2)11-14(19,20)21)9-6-27(3)12-15(22,23)24/h4-12H2,1-3H3 |
| InChIKey | QENCXBKBSSSLBC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |