C11H19F3N2 — CID 106709854
2,2-dimethyl-6-[methyl(2,2,2-trifluoroethyl)amino]hexanenitrile (PubChem CID 106709854) has the molecular formula C11H19F3N2 and a molecular weight of 236.28 g/mol. Its IUPAC name is 2,2-dimethyl-6-[methyl(2,2,2-trifluoroethyl)amino]hexanenitrile.
| Compound Name | 2,2-dimethyl-6-[methyl(2,2,2-trifluoroethyl)amino]hexanenitrile |
|---|---|
| PubChem CID | 106709854 |
| Molecular Formula | C11H19F3N2 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 2,2-dimethyl-6-[methyl(2,2,2-trifluoroethyl)amino]hexanenitrile |
| SMILES | CN(CCCCC(C)(C)C#N)CC(F)(F)F |
| InChI | InChI=1S/C11H19F3N2/c1-10(2,8-15)6-4-5-7-16(3)9-11(12,13)14/h4-7,9H2,1-3H3 |
| InChIKey | LTYODIBQQHNRPD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|