C14H21ClN2S — CID 106709895
6-[(5-chlorothiophen-2-yl)methyl-methylamino]-2,2-dimethylhexanenitrile (PubChem CID 106709895) has the molecular formula C14H21ClN2S and a molecular weight of 284.86 g/mol. Its IUPAC name is 6-[(5-chlorothiophen-2-yl)methyl-methylamino]-2,2-dimethylhexanenitrile.
| Compound Name | 6-[(5-chlorothiophen-2-yl)methyl-methylamino]-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106709895 |
| Molecular Formula | C14H21ClN2S |
| Molecular Weight | 284.86 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 6-[(5-chlorothiophen-2-yl)methyl-methylamino]-2,2-dimethylhexanenitrile |
| SMILES | CN(CCCCC(C)(C)C#N)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C14H21ClN2S/c1-14(2,11-16)8-4-5-9-17(3)10-12-6-7-13(15)18-12/h6-7H,4-5,8-10H2,1-3H3 |
| InChIKey | VICUOKBWMKQDCI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.86 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|