C13H20ClNO2S — CID 62272699
2-[[(5-chlorothiophen-2-yl)methyl-methylamino]methyl]-2-methylpentanoic acid (PubChem CID 62272699) has the molecular formula C13H20ClNO2S and a molecular weight of 289.83 g/mol. Its IUPAC name is 2-[[(5-chlorothiophen-2-yl)methyl-methylamino]methyl]-2-methylpentanoic acid.
| Compound Name | 2-[[(5-chlorothiophen-2-yl)methyl-methylamino]methyl]-2-methylpentanoic acid |
|---|---|
| PubChem CID | 62272699 |
| Molecular Formula | C13H20ClNO2S |
| Molecular Weight | 289.83 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 2-[[(5-chlorothiophen-2-yl)methyl-methylamino]methyl]-2-methylpentanoic acid |
| SMILES | CCCC(C)(CN(C)Cc1ccc(Cl)s1)C(=O)O |
| InChI | InChI=1S/C13H20ClNO2S/c1-4-7-13(2,12(16)17)9-15(3)8-10-5-6-11(14)18-10/h5-6H,4,7-9H2,1-3H3,(H,16,17) |
| InChIKey | SQPZKHONYRDLPN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.83 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |