C16H29ClN2S — CID 63494592
N-[(5-chlorothiophen-2-yl)methyl]-2,2-diethyl-N-methyl-N'-propylpropane-1,3-diamine (PubChem CID 63494592) has the molecular formula C16H29ClN2S and a molecular weight of 316.94 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-2,2-diethyl-N-methyl-N'-propylpropane-1,3-diamine.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-2,2-diethyl-N-methyl-N'-propylpropane-1,3-diamine |
|---|---|
| PubChem CID | 63494592 |
| Molecular Formula | C16H29ClN2S |
| Molecular Weight | 316.94 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-2,2-diethyl-N-methyl-N'-propylpropane-1,3-diamine |
| SMILES | CCCNCC(CC)(CC)CN(C)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C16H29ClN2S/c1-5-10-18-12-16(6-2,7-3)13-19(4)11-14-8-9-15(17)20-14/h8-9,18H,5-7,10-13H2,1-4H3 |
| InChIKey | KSZQUXJYLBOOBH-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.94 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|