C7H12ClN3S — CID 115260926
1-(5-chlorothiophen-2-yl)-N-(hydrazinylmethyl)-N-methylmethanamine (PubChem CID 115260926) has the molecular formula C7H12ClN3S and a molecular weight of 205.71 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-N-(hydrazinylmethyl)-N-methylmethanamine.
| Compound Name | 1-(5-chlorothiophen-2-yl)-N-(hydrazinylmethyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 115260926 |
| Molecular Formula | C7H12ClN3S |
| Molecular Weight | 205.71 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-N-(hydrazinylmethyl)-N-methylmethanamine |
| SMILES | CN(CNN)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C7H12ClN3S/c1-11(5-10-9)4-6-2-3-7(8)12-6/h2-3,10H,4-5,9H2,1H3 |
| InChIKey | PXZGZCNPOFBYMO-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.71 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|