C8H12ClN3S — CID 61442075
2-[(5-chlorothiophen-2-yl)methyl-methylamino]ethanimidamide (PubChem CID 61442075) has the molecular formula C8H12ClN3S and a molecular weight of 217.73 g/mol. Its IUPAC name is 2-[(5-chlorothiophen-2-yl)methyl-methylamino]ethanimidamide.
| Compound Name | 2-[(5-chlorothiophen-2-yl)methyl-methylamino]ethanimidamide |
|---|---|
| PubChem CID | 61442075 |
| Molecular Formula | C8H12ClN3S |
| Molecular Weight | 217.73 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 2-[(5-chlorothiophen-2-yl)methyl-methylamino]ethanimidamide |
| SMILES | [H]/N=C(\N)CN(C)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C8H12ClN3S/c1-12(5-8(10)11)4-6-2-3-7(9)13-6/h2-3H,4-5H2,1H3,(H3,10,11) |
| InChIKey | ACWBGOPWOWKNBB-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.73 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|