C9H12ClN3OS2 — CID 36522118
[2-[(5-chlorothiophen-2-yl)methyl-methylamino]-2-oxoethyl] carbamimidothioate (PubChem CID 36522118) has the molecular formula C9H12ClN3OS2 and a molecular weight of 277.80 g/mol. Its IUPAC name is [2-[(5-chlorothiophen-2-yl)methyl-methylamino]-2-oxoethyl] carbamimidothioate.
| Compound Name | [2-[(5-chlorothiophen-2-yl)methyl-methylamino]-2-oxoethyl] carbamimidothioate |
|---|---|
| PubChem CID | 36522118 |
| Molecular Formula | C9H12ClN3OS2 |
| Molecular Weight | 277.80 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | [2-[(5-chlorothiophen-2-yl)methyl-methylamino]-2-oxoethyl] carbamimidothioate |
| SMILES | [H]/N=C(\N)SCC(=O)N(C)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C9H12ClN3OS2/c1-13(8(14)5-15-9(11)12)4-6-2-3-7(10)16-6/h2-3H,4-5H2,1H3,(H3,11,12) |
| InChIKey | YIQOAPLWYAXAAN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 70.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.80 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|