C15H17ClN2OS2 — CID 79129036
2-(4-amino-3-methylphenyl)sulfanyl-N-[(5-chlorothiophen-2-yl)methyl]-N-methylacetamide (PubChem CID 79129036) has the molecular formula C15H17ClN2OS2 and a molecular weight of 340.90 g/mol. Its IUPAC name is 2-(4-amino-3-methylphenyl)sulfanyl-N-[(5-chlorothiophen-2-yl)methyl]-N-methylacetamide.
| Compound Name | 2-(4-amino-3-methylphenyl)sulfanyl-N-[(5-chlorothiophen-2-yl)methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 79129036 |
| Molecular Formula | C15H17ClN2OS2 |
| Molecular Weight | 340.90 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 2-(4-amino-3-methylphenyl)sulfanyl-N-[(5-chlorothiophen-2-yl)methyl]-N-methylacetamide |
| SMILES | Cc1cc(SCC(=O)N(C)Cc2ccc(Cl)s2)ccc1N |
| InChI | InChI=1S/C15H17ClN2OS2/c1-10-7-11(3-5-13(10)17)20-9-15(19)18(2)8-12-4-6-14(16)21-12/h3-7H,8-9,17H2,1-2H3 |
| InChIKey | YXLRWAURIPSXLD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.90 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|