C14H14Cl2N2OS2 — CID 79127346
2-(5-amino-2-chlorophenyl)sulfanyl-N-[(5-chlorothiophen-2-yl)methyl]-N-methylacetamide (PubChem CID 79127346) has the molecular formula C14H14Cl2N2OS2 and a molecular weight of 361.32 g/mol. Its IUPAC name is 2-(5-amino-2-chlorophenyl)sulfanyl-N-[(5-chlorothiophen-2-yl)methyl]-N-methylacetamide.
| Compound Name | 2-(5-amino-2-chlorophenyl)sulfanyl-N-[(5-chlorothiophen-2-yl)methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 79127346 |
| Molecular Formula | C14H14Cl2N2OS2 |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 359.99 |
| IUPAC Name | 2-(5-amino-2-chlorophenyl)sulfanyl-N-[(5-chlorothiophen-2-yl)methyl]-N-methylacetamide |
| SMILES | CN(Cc1ccc(Cl)s1)C(=O)CSc1cc(N)ccc1Cl |
| InChI | InChI=1S/C14H14Cl2N2OS2/c1-18(7-10-3-5-13(16)21-10)14(19)8-20-12-6-9(17)2-4-11(12)15/h2-6H,7-8,17H2,1H3 |
| InChIKey | JHLZMEXRVYCQJY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|