C11H18ClN3OS — CID 55103655
2-[2-aminoethyl(methyl)amino]-N-[(5-chlorothiophen-2-yl)methyl]-N-methylacetamide (PubChem CID 55103655) has the molecular formula C11H18ClN3OS and a molecular weight of 275.81 g/mol. Its IUPAC name is 2-[2-aminoethyl(methyl)amino]-N-[(5-chlorothiophen-2-yl)methyl]-N-methylacetamide.
| Compound Name | 2-[2-aminoethyl(methyl)amino]-N-[(5-chlorothiophen-2-yl)methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 55103655 |
| Molecular Formula | C11H18ClN3OS |
| Molecular Weight | 275.81 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 2-[2-aminoethyl(methyl)amino]-N-[(5-chlorothiophen-2-yl)methyl]-N-methylacetamide |
| SMILES | CN(CCN)CC(=O)N(C)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C11H18ClN3OS/c1-14(6-5-13)8-11(16)15(2)7-9-3-4-10(12)17-9/h3-4H,5-8,13H2,1-2H3 |
| InChIKey | NGAKMAXHXCXQEQ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.81 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |