C18H24ClN3OS — CID 120871808
2-[2-aminoethyl(2-phenylethyl)amino]-N-[(5-chlorothiophen-2-yl)methyl]-N-methylacetamide (PubChem CID 120871808) has the molecular formula C18H24ClN3OS and a molecular weight of 365.93 g/mol. Its IUPAC name is 2-[2-aminoethyl(2-phenylethyl)amino]-N-[(5-chlorothiophen-2-yl)methyl]-N-methylacetamide.
| Compound Name | 2-[2-aminoethyl(2-phenylethyl)amino]-N-[(5-chlorothiophen-2-yl)methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 120871808 |
| Molecular Formula | C18H24ClN3OS |
| Molecular Weight | 365.93 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 2-[2-aminoethyl(2-phenylethyl)amino]-N-[(5-chlorothiophen-2-yl)methyl]-N-methylacetamide |
| SMILES | CN(Cc1ccc(Cl)s1)C(=O)CN(CCN)CCc1ccccc1 |
| InChI | InChI=1S/C18H24ClN3OS/c1-21(13-16-7-8-17(19)24-16)18(23)14-22(12-10-20)11-9-15-5-3-2-4-6-15/h2-8H,9-14,20H2,1H3 |
| InChIKey | SAKDXAUBEOHHEH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.93 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |