C17H20ClNO3S2 — CID 55687936
N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-2-(3-phenylpropylsulfonyl)acetamide (PubChem CID 55687936) has the molecular formula C17H20ClNO3S2 and a molecular weight of 385.94 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-2-(3-phenylpropylsulfonyl)acetamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-2-(3-phenylpropylsulfonyl)acetamide |
|---|---|
| PubChem CID | 55687936 |
| Molecular Formula | C17H20ClNO3S2 |
| Molecular Weight | 385.94 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-2-(3-phenylpropylsulfonyl)acetamide |
| SMILES | CN(Cc1ccc(Cl)s1)C(=O)CS(=O)(=O)CCCc1ccccc1 |
| InChI | InChI=1S/C17H20ClNO3S2/c1-19(12-15-9-10-16(18)23-15)17(20)13-24(21,22)11-5-8-14-6-3-2-4-7-14/h2-4,6-7,9-10H,5,8,11-13H2,1H3 |
| InChIKey | FWBNGGAKCBKFTF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.94 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |