C15H17N3O3S — CID 60612812
N,N-bis(cyanomethyl)-2-(3-phenylpropylsulfonyl)acetamide (PubChem CID 60612812) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is N,N-bis(cyanomethyl)-2-(3-phenylpropylsulfonyl)acetamide.
| Compound Name | N,N-bis(cyanomethyl)-2-(3-phenylpropylsulfonyl)acetamide |
|---|---|
| PubChem CID | 60612812 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | N,N-bis(cyanomethyl)-2-(3-phenylpropylsulfonyl)acetamide |
| SMILES | N#CCN(CC#N)C(=O)CS(=O)(=O)CCCc1ccccc1 |
| InChI | InChI=1S/C15H17N3O3S/c16-8-10-18(11-9-17)15(19)13-22(20,21)12-4-7-14-5-2-1-3-6-14/h1-3,5-6H,4,7,10-13H2 |
| InChIKey | AKVNSQFWVWNGHU-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 102.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|