C10H15NO4S2 — CID 14460415
3-phenylpropylsulfonylmethanesulfonamide (PubChem CID 14460415) has the molecular formula C10H15NO4S2 and a molecular weight of 277.37 g/mol. Its IUPAC name is 3-phenylpropylsulfonylmethanesulfonamide.
| Compound Name | 3-phenylpropylsulfonylmethanesulfonamide |
|---|---|
| PubChem CID | 14460415 |
| Molecular Formula | C10H15NO4S2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 3-phenylpropylsulfonylmethanesulfonamide |
| SMILES | NS(=O)(=O)CS(=O)(=O)CCCc1ccccc1 |
| InChI | InChI=1S/C10H15NO4S2/c11-17(14,15)9-16(12,13)8-4-7-10-5-2-1-3-6-10/h1-3,5-6H,4,7-9H2,(H2,11,14,15) |
| InChIKey | NGRSKGPAQBKOJC-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |