C20H26O2S — CID 52541496
1-tert-butyl-4-(3-phenylpropylsulfonylmethyl)benzene (PubChem CID 52541496) has the molecular formula C20H26O2S and a molecular weight of 330.49 g/mol. Its IUPAC name is 1-tert-butyl-4-(3-phenylpropylsulfonylmethyl)benzene.
| Compound Name | 1-tert-butyl-4-(3-phenylpropylsulfonylmethyl)benzene |
|---|---|
| PubChem CID | 52541496 |
| Molecular Formula | C20H26O2S |
| Molecular Weight | 330.49 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 1-tert-butyl-4-(3-phenylpropylsulfonylmethyl)benzene |
| SMILES | CC(C)(C)c1ccc(CS(=O)(=O)CCCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H26O2S/c1-20(2,3)19-13-11-18(12-14-19)16-23(21,22)15-7-10-17-8-5-4-6-9-17/h4-6,8-9,11-14H,7,10,15-16H2,1-3H3 |
| InChIKey | KGHJCGYSJOWJBN-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |