C13H16N2O3S — CID 126804224
3-methyl-5-(3-phenylpropylsulfonylmethyl)-1,2,4-oxadiazole (PubChem CID 126804224) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is 3-methyl-5-(3-phenylpropylsulfonylmethyl)-1,2,4-oxadiazole.
| Compound Name | 3-methyl-5-(3-phenylpropylsulfonylmethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 126804224 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 3-methyl-5-(3-phenylpropylsulfonylmethyl)-1,2,4-oxadiazole |
| SMILES | Cc1noc(CS(=O)(=O)CCCc2ccccc2)n1 |
| InChI | InChI=1S/C13H16N2O3S/c1-11-14-13(18-15-11)10-19(16,17)9-5-8-12-6-3-2-4-7-12/h2-4,6-7H,5,8-10H2,1H3 |
| InChIKey | PGIXMKVCGGGSHU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 73.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |