C13H15N3O4S — CID 97046634
N-benzylsulfonyl-3-(3-methyl-1,2,4-oxadiazol-5-yl)propanamide (PubChem CID 97046634) has the molecular formula C13H15N3O4S and a molecular weight of 309.35 g/mol. Its IUPAC name is N-benzylsulfonyl-3-(3-methyl-1,2,4-oxadiazol-5-yl)propanamide.
| Compound Name | N-benzylsulfonyl-3-(3-methyl-1,2,4-oxadiazol-5-yl)propanamide |
|---|---|
| PubChem CID | 97046634 |
| Molecular Formula | C13H15N3O4S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | N-benzylsulfonyl-3-(3-methyl-1,2,4-oxadiazol-5-yl)propanamide |
| SMILES | Cc1noc(CCC(=O)NS(=O)(=O)Cc2ccccc2)n1 |
| InChI | InChI=1S/C13H15N3O4S/c1-10-14-13(20-15-10)8-7-12(17)16-21(18,19)9-11-5-3-2-4-6-11/h2-6H,7-9H2,1H3,(H,16,17) |
| InChIKey | ADVZJJXPBNJJKI-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |