About potassium;hydride;2-phenylethanesulfonamide
potassium;hydride;2-phenylethanesulfonamide (PubChem CID 173120901) has the molecular formula C8H12KNO2S
and a molecular weight of 225.35 g/mol. Its IUPAC name is potassium;hydride;2-phenylethanesulfonamide.
Molecular Properties
| Compound Name | potassium;hydride;2-phenylethanesulfonamide |
| PubChem CID | 173120901 |
| Molecular Formula | C8H12KNO2S |
| Molecular Weight | 225.35 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | potassium;hydride;2-phenylethanesulfonamide |
| SMILES | NS(=O)(=O)CCc1ccccc1.[H-].[K+] |
| InChI | InChI=1S/C8H11NO2S.K.H/c9-12(10,11)7-6-8-4-2-1-3-5-8;;/h1-5H,6-7H2,(H2,9,10,11);;/q;+1;-1 |
| InChIKey | MEVHTQZJUSSMGX-UHFFFAOYSA-N |
| XLogP | -2.37 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.35 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze potassium;hydride;2-phenylethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydride;2-phenylethanesulfonamide?
The IUPAC name of potassium;hydride;2-phenylethanesulfonamide (CID 173120901) is potassium;hydride;2-phenylethanesulfonamide.
What is the SMILES notation for potassium;hydride;2-phenylethanesulfonamide?
The canonical SMILES for potassium;hydride;2-phenylethanesulfonamide is NS(=O)(=O)CCc1ccccc1.[H-].[K+].
What is the InChIKey of potassium;hydride;2-phenylethanesulfonamide?
The InChIKey is MEVHTQZJUSSMGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2S.K.H/c9-12(10,11)7-6-8-4-2-1-3-5-8;;/h1-5H,6-7H2,(H2,9,10,11);;/q;+1;-1.
What are the key properties of potassium;hydride;2-phenylethanesulfonamide?
potassium;hydride;2-phenylethanesulfonamide has a molecular weight of 225.35 g/mol, XLogP of -2.37, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;2-phenylethanesulfonamide is sourced from PubChem (CID 173120901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).