C13H22N2O2S — CID 115690814
2-[(2-methyl-4-phenylbutan-2-yl)amino]ethanesulfonamide (PubChem CID 115690814) has the molecular formula C13H22N2O2S and a molecular weight of 270.40 g/mol. Its IUPAC name is 2-[(2-methyl-4-phenylbutan-2-yl)amino]ethanesulfonamide.
| Compound Name | 2-[(2-methyl-4-phenylbutan-2-yl)amino]ethanesulfonamide |
|---|---|
| PubChem CID | 115690814 |
| Molecular Formula | C13H22N2O2S |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 2-[(2-methyl-4-phenylbutan-2-yl)amino]ethanesulfonamide |
| SMILES | CC(C)(CCc1ccccc1)NCCS(N)(=O)=O |
| InChI | InChI=1S/C13H22N2O2S/c1-13(2,15-10-11-18(14,16)17)9-8-12-6-4-3-5-7-12/h3-7,15H,8-11H2,1-2H3,(H2,14,16,17) |
| InChIKey | AWRGENPGAUTXSS-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |