C14H23NO2 — CID 12855751
3-[(2-methyl-4-phenylbutan-2-yl)amino]propane-1,2-diol (PubChem CID 12855751) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is 3-[(2-methyl-4-phenylbutan-2-yl)amino]propane-1,2-diol.
| Compound Name | 3-[(2-methyl-4-phenylbutan-2-yl)amino]propane-1,2-diol |
|---|---|
| PubChem CID | 12855751 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | 3-[(2-methyl-4-phenylbutan-2-yl)amino]propane-1,2-diol |
| SMILES | CC(C)(CCc1ccccc1)NCC(O)CO |
| InChI | InChI=1S/C14H23NO2/c1-14(2,15-10-13(17)11-16)9-8-12-6-4-3-5-7-12/h3-7,13,15-17H,8-11H2,1-2H3 |
| InChIKey | ZBSIVAZNMTWIKL-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |