C13H19NO3 — CID 114990394
2-(2-hydroxyethylamino)-2-methyl-4-phenylbutanoic acid (PubChem CID 114990394) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-(2-hydroxyethylamino)-2-methyl-4-phenylbutanoic acid.
| Compound Name | 2-(2-hydroxyethylamino)-2-methyl-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 114990394 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 2-(2-hydroxyethylamino)-2-methyl-4-phenylbutanoic acid |
| SMILES | CC(CCc1ccccc1)(NCCO)C(=O)O |
| InChI | InChI=1S/C13H19NO3/c1-13(12(16)17,14-9-10-15)8-7-11-5-3-2-4-6-11/h2-6,14-15H,7-10H2,1H3,(H,16,17) |
| InChIKey | SHIFACKPSQZTSW-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |