C19H26N2O2 — CID 12855748
1-[(2-methyl-4-phenylbutan-2-yl)amino]-3-pyridin-4-yloxypropan-2-ol (PubChem CID 12855748) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 1-[(2-methyl-4-phenylbutan-2-yl)amino]-3-pyridin-4-yloxypropan-2-ol.
| Compound Name | 1-[(2-methyl-4-phenylbutan-2-yl)amino]-3-pyridin-4-yloxypropan-2-ol |
|---|---|
| PubChem CID | 12855748 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 1-[(2-methyl-4-phenylbutan-2-yl)amino]-3-pyridin-4-yloxypropan-2-ol |
| SMILES | CC(C)(CCc1ccccc1)NCC(O)COc1ccncc1 |
| InChI | InChI=1S/C19H26N2O2/c1-19(2,11-8-16-6-4-3-5-7-16)21-14-17(22)15-23-18-9-12-20-13-10-18/h3-7,9-10,12-13,17,21-22H,8,11,14-15H2,1-2H3 |
| InChIKey | NBHITJIQHKKAHN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |