C28H36N2O4 — CID 41066855
(2R)-1-[4-[(2R)-2-hydroxy-3-(2-phenylethylamino)propoxy]phenoxy]-3-(2-phenylethylamino)propan-2-ol (PubChem CID 41066855) has the molecular formula C28H36N2O4 and a molecular weight of 464.61 g/mol. Its IUPAC name is (2R)-1-[4-[(2R)-2-hydroxy-3-(2-phenylethylamino)propoxy]phenoxy]-3-(2-phenylethylamino)propan-2-ol.
| Compound Name | (2R)-1-[4-[(2R)-2-hydroxy-3-(2-phenylethylamino)propoxy]phenoxy]-3-(2-phenylethylamino)propan-2-ol |
|---|---|
| PubChem CID | 41066855 |
| Molecular Formula | C28H36N2O4 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | (2R)-1-[4-[(2R)-2-hydroxy-3-(2-phenylethylamino)propoxy]phenoxy]-3-(2-phenylethylamino)propan-2-ol |
| SMILES | O[C@H](CNCCc1ccccc1)COc1ccc(OC[C@H](O)CNCCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H36N2O4/c31-25(19-29-17-15-23-7-3-1-4-8-23)21-33-27-11-13-28(14-12-27)34-22-26(32)20-30-18-16-24-9-5-2-6-10-24/h1-14,25-26,29-32H,15-22H2/t25-,26-/m1/s1 |
| InChIKey | GGHVOBZSGLNUTN-CLJLJLNGSA-N |
| XLogP | 2.83 |
| TPSA | 82.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|