C37H36NO5P — CID 67702307
1-[2-[4-[diphenyl(phosphoroso)methoxy]phenyl]ethylamino]-3-(4-phenylmethoxyphenoxy)propan-2-ol (PubChem CID 67702307) has the molecular formula C37H36NO5P and a molecular weight of 605.67 g/mol. Its IUPAC name is 1-[2-[4-[diphenyl(phosphoroso)methoxy]phenyl]ethylamino]-3-(4-phenylmethoxyphenoxy)propan-2-ol.
| Compound Name | 1-[2-[4-[diphenyl(phosphoroso)methoxy]phenyl]ethylamino]-3-(4-phenylmethoxyphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 67702307 |
| Molecular Formula | C37H36NO5P |
| Molecular Weight | 605.67 g/mol |
| Exact Mass | 605.23 |
| IUPAC Name | 1-[2-[4-[diphenyl(phosphoroso)methoxy]phenyl]ethylamino]-3-(4-phenylmethoxyphenoxy)propan-2-ol |
| SMILES | O=PC(Oc1ccc(CCNCC(O)COc2ccc(OCc3ccccc3)cc2)cc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H36NO5P/c39-33(28-42-35-22-20-34(21-23-35)41-27-30-10-4-1-5-11-30)26-38-25-24-29-16-18-36(19-17-29)43-37(44-40,31-12-6-2-7-13-31)32-14-8-3-9-15-32/h1-23,33,38-39H,24-28H2 |
| InChIKey | HSWLHHOINCCGNG-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.67 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|