C26H29NO7 — CID 54439100
4-[[4-[2-[[(2S)-2-hydroxy-3-[4-hydroxy-3-(hydroxymethyl)phenoxy]propyl]amino]ethyl]phenoxy]methyl]benzoic acid (PubChem CID 54439100) has the molecular formula C26H29NO7 and a molecular weight of 467.52 g/mol. Its IUPAC name is 4-[[4-[2-[[(2S)-2-hydroxy-3-[4-hydroxy-3-(hydroxymethyl)phenoxy]propyl]amino]ethyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[2-[[(2S)-2-hydroxy-3-[4-hydroxy-3-(hydroxymethyl)phenoxy]propyl]amino]ethyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 54439100 |
| Molecular Formula | C26H29NO7 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 4-[[4-[2-[[(2S)-2-hydroxy-3-[4-hydroxy-3-(hydroxymethyl)phenoxy]propyl]amino]ethyl]phenoxy]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(COc2ccc(CCNC[C@H](O)COc3ccc(O)c(CO)c3)cc2)cc1 |
| InChI | InChI=1S/C26H29NO7/c28-15-21-13-24(9-10-25(21)30)34-17-22(29)14-27-12-11-18-3-7-23(8-4-18)33-16-19-1-5-20(6-2-19)26(31)32/h1-10,13,22,27-30H,11-12,14-17H2,(H,31,32)/t22-/m0/s1 |
| InChIKey | WMUVKJQASICLII-QFIPXVFZSA-N |
| XLogP | 2.73 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|