C19H23NO5 — CID 15714008
2-[4-[2-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]ethyl]phenoxy]acetic acid (PubChem CID 15714008) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is 2-[4-[2-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]ethyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[2-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]ethyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 15714008 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 2-[4-[2-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]ethyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(CCNC[C@H](O)COc2ccccc2)cc1 |
| InChI | InChI=1S/C19H23NO5/c21-16(13-24-17-4-2-1-3-5-17)12-20-11-10-15-6-8-18(9-7-15)25-14-19(22)23/h1-9,16,20-21H,10-14H2,(H,22,23)/t16-/m0/s1 |
| InChIKey | VCNRIGMDVLIHQL-INIZCTEOSA-N |
| XLogP | 1.72 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|