C21H26N2O8 — CID 13030874
N-[2-[(2-hydroxy-3-phenoxypropyl)amino]ethyl]-2-phenoxyacetamide;oxalic acid (PubChem CID 13030874) has the molecular formula C21H26N2O8 and a molecular weight of 434.45 g/mol. Its IUPAC name is N-[2-[(2-hydroxy-3-phenoxypropyl)amino]ethyl]-2-phenoxyacetamide;oxalic acid.
| Compound Name | N-[2-[(2-hydroxy-3-phenoxypropyl)amino]ethyl]-2-phenoxyacetamide;oxalic acid |
|---|---|
| PubChem CID | 13030874 |
| Molecular Formula | C21H26N2O8 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | N-[2-[(2-hydroxy-3-phenoxypropyl)amino]ethyl]-2-phenoxyacetamide;oxalic acid |
| SMILES | O=C(COc1ccccc1)NCCNCC(O)COc1ccccc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H24N2O4.C2H2O4/c22-16(14-24-17-7-3-1-4-8-17)13-20-11-12-21-19(23)15-25-18-9-5-2-6-10-18;3-1(4)2(5)6/h1-10,16,20,22H,11-15H2,(H,21,23);(H,3,4)(H,5,6) |
| InChIKey | OQCKRFNDUAMVEB-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 154.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|