C18H22N2O3 — CID 21426688
N-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]-2-phenoxyacetamide (PubChem CID 21426688) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is N-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]-2-phenoxyacetamide.
| Compound Name | N-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 21426688 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | N-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)NCCNCC(O)c1ccccc1 |
| InChI | InChI=1S/C18H22N2O3/c21-17(15-7-3-1-4-8-15)13-19-11-12-20-18(22)14-23-16-9-5-2-6-10-16/h1-10,17,19,21H,11-14H2,(H,20,22) |
| InChIKey | GESCCEANKMFMEN-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|