C20H26N2O5 — CID 15174968
2-[3-[2-[(2-hydroxy-3-phenoxypropyl)amino]ethoxy]phenoxy]-N-methylacetamide (PubChem CID 15174968) has the molecular formula C20H26N2O5 and a molecular weight of 374.44 g/mol. Its IUPAC name is 2-[3-[2-[(2-hydroxy-3-phenoxypropyl)amino]ethoxy]phenoxy]-N-methylacetamide.
| Compound Name | 2-[3-[2-[(2-hydroxy-3-phenoxypropyl)amino]ethoxy]phenoxy]-N-methylacetamide |
|---|---|
| PubChem CID | 15174968 |
| Molecular Formula | C20H26N2O5 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 2-[3-[2-[(2-hydroxy-3-phenoxypropyl)amino]ethoxy]phenoxy]-N-methylacetamide |
| SMILES | CNC(=O)COc1cccc(OCCNCC(O)COc2ccccc2)c1 |
| InChI | InChI=1S/C20H26N2O5/c1-21-20(24)15-27-19-9-5-8-18(12-19)25-11-10-22-13-16(23)14-26-17-6-3-2-4-7-17/h2-9,12,16,22-23H,10-11,13-15H2,1H3,(H,21,24) |
| InChIKey | QGEJFHCLNCUVHK-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|